C6H14O10P2 — CID 516
3-hydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylpentanoic acid (PubChem CID 516) has the molecular formula C6H14O10P2 and a molecular weight of 308.12 g/mol. Its IUPAC name is 3-hydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylpentanoic acid.
| Compound Name | 3-hydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylpentanoic acid |
|---|---|
| PubChem CID | 516 |
| Molecular Formula | C6H14O10P2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 3-hydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylpentanoic acid |
| SMILES | CC(O)(CCOP(=O)(O)OP(=O)(O)O)CC(=O)O |
| InChI | InChI=1S/C6H14O10P2/c1-6(9,4-5(7)8)2-3-15-18(13,14)16-17(10,11)12/h9H,2-4H2,1H3,(H,7,8)(H,13,14)(H2,10,11,12) |
| InChIKey | SIGQQUBJQXSAMW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|