C17H15N3O3S — CID 51601518
(2R)-3-(4-ethoxyphenyl)-2-(furan-2-yl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile (PubChem CID 51601518) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is (2R)-3-(4-ethoxyphenyl)-2-(furan-2-yl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile.
| Compound Name | (2R)-3-(4-ethoxyphenyl)-2-(furan-2-yl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 51601518 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (2R)-3-(4-ethoxyphenyl)-2-(furan-2-yl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
| SMILES | CCOc1ccc(N2C(S)=C(C#N)C(=O)N[C@H]2c2ccco2)cc1 |
| InChI | InChI=1S/C17H15N3O3S/c1-2-22-12-7-5-11(6-8-12)20-15(14-4-3-9-23-14)19-16(21)13(10-18)17(20)24/h3-9,15,24H,2H2,1H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | JQVNZJQTIPDBIB-OAHLLOKOSA-N |
| XLogP | 2.98 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|