C25H23N5O3S2 — CID 51609530
(7S)-2-[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 51609530) has the molecular formula C25H23N5O3S2 and a molecular weight of 505.63 g/mol. Its IUPAC name is (7S)-2-[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-2-[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 51609530 |
| Molecular Formula | C25H23N5O3S2 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | (7S)-2-[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCc1nn2c(=O)cc(COc3ccc(-c4nc5sc6c(c5c(=O)[nH]4)CC[C@H](C)C6)cc3)nc2s1 |
| InChI | InChI=1S/C25H23N5O3S2/c1-3-19-29-30-20(31)11-15(26-25(30)35-19)12-33-16-7-5-14(6-8-16)22-27-23(32)21-17-9-4-13(2)10-18(17)34-24(21)28-22/h5-8,11,13H,3-4,9-10,12H2,1-2H3,(H,27,28,32)/t13-/m0/s1 |
| InChIKey | DORDBONHPRXSHF-ZDUSSCGKSA-N |
| XLogP | 4.38 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |