C23H21N3O2S — CID 5160986
1-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-3-phenoxypropan-2-ol (PubChem CID 5160986) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 1-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-3-phenoxypropan-2-ol.
| Compound Name | 1-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 5160986 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-3-phenoxypropan-2-ol |
| SMILES | OC(COc1ccccc1)CSc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H21N3O2S/c27-20(16-28-21-14-8-3-9-15-21)17-29-23-25-24-22(18-10-4-1-5-11-18)26(23)19-12-6-2-7-13-19/h1-15,20,27H,16-17H2 |
| InChIKey | WVUQSAKCVPOAOZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |