C17H21BrN2O2 — CID 5160999
5-(3-bromophenyl)-1-(3-ethoxypropyl)-2-methylpyrrole-3-carboxamide (PubChem CID 5160999) has the molecular formula C17H21BrN2O2 and a molecular weight of 365.27 g/mol. Its IUPAC name is 5-(3-bromophenyl)-1-(3-ethoxypropyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | 5-(3-bromophenyl)-1-(3-ethoxypropyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 5160999 |
| Molecular Formula | C17H21BrN2O2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 5-(3-bromophenyl)-1-(3-ethoxypropyl)-2-methylpyrrole-3-carboxamide |
| SMILES | CCOCCCn1c(-c2cccc(Br)c2)cc(C(N)=O)c1C |
| InChI | InChI=1S/C17H21BrN2O2/c1-3-22-9-5-8-20-12(2)15(17(19)21)11-16(20)13-6-4-7-14(18)10-13/h4,6-7,10-11H,3,5,8-9H2,1-2H3,(H2,19,21) |
| InChIKey | OOOUGECSAQEDMW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|