C18H23BrN2O2 — CID 3849913
5-(4-bromophenyl)-1-(3-ethoxypropyl)-2,4-dimethylpyrrole-3-carboxamide (PubChem CID 3849913) has the molecular formula C18H23BrN2O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 5-(4-bromophenyl)-1-(3-ethoxypropyl)-2,4-dimethylpyrrole-3-carboxamide.
| Compound Name | 5-(4-bromophenyl)-1-(3-ethoxypropyl)-2,4-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3849913 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 5-(4-bromophenyl)-1-(3-ethoxypropyl)-2,4-dimethylpyrrole-3-carboxamide |
| SMILES | CCOCCCn1c(C)c(C(N)=O)c(C)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H23BrN2O2/c1-4-23-11-5-10-21-13(3)16(18(20)22)12(2)17(21)14-6-8-15(19)9-7-14/h6-9H,4-5,10-11H2,1-3H3,(H2,20,22) |
| InChIKey | AHENVGKEFJKAPM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|