C19H26N2O3 — CID 3858610
1-(3-ethoxypropyl)-4-(2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 3858610) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-4-(2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(3-ethoxypropyl)-4-(2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3858610 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-(3-ethoxypropyl)-4-(2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | CCOCCCn1c(C)c(C(N)=O)c(-c2ccccc2OC)c1C |
| InChI | InChI=1S/C19H26N2O3/c1-5-24-12-8-11-21-13(2)17(18(14(21)3)19(20)22)15-9-6-7-10-16(15)23-4/h6-7,9-10H,5,8,11-12H2,1-4H3,(H2,20,22) |
| InChIKey | CYAQUCLKJQAFDY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|