C16H20N4O — CID 51612994
(2R)-2-(2-ethylpyrazol-3-yl)-N-phenylpyrrolidine-1-carboxamide (PubChem CID 51612994) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is (2R)-2-(2-ethylpyrazol-3-yl)-N-phenylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-(2-ethylpyrazol-3-yl)-N-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51612994 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (2R)-2-(2-ethylpyrazol-3-yl)-N-phenylpyrrolidine-1-carboxamide |
| SMILES | CCn1nccc1[C@H]1CCCN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H20N4O/c1-2-20-15(10-11-17-20)14-9-6-12-19(14)16(21)18-13-7-4-3-5-8-13/h3-5,7-8,10-11,14H,2,6,9,12H2,1H3,(H,18,21)/t14-/m1/s1 |
| InChIKey | JTGMFFLGQADYPL-CQSZACIVSA-N |
| XLogP | 3.27 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |