C22H32IN5O — CID 120581740
N'-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 120581740) has the molecular formula C22H32IN5O and a molecular weight of 509.44 g/mol. Its IUPAC name is N'-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120581740 |
| Molecular Formula | C22H32IN5O |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | N'-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCn1nccc1[C@@H]1OCC[C@H]1C/N=C(/Nc1ccccc1)N1CCCCC1.I |
| InChI | InChI=1S/C22H31N5O.HI/c1-2-27-20(11-13-24-27)21-18(12-16-28-21)17-23-22(26-14-7-4-8-15-26)25-19-9-5-3-6-10-19;/h3,5-6,9-11,13,18,21H,2,4,7-8,12,14-17H2,1H3,(H,23,25);1H/t18-,21+;/m0./s1 |
| InChIKey | TWNBVLACTYNTKN-OZYANKIXSA-N |
| XLogP | 4.55 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|