C16H29F3N2 — CID 51633656
(3S)-1-(cyclohexylmethyl)-N-(4,4,4-trifluorobutyl)piperidin-3-amine (PubChem CID 51633656) has the molecular formula C16H29F3N2 and a molecular weight of 306.42 g/mol. Its IUPAC name is (3S)-1-(cyclohexylmethyl)-N-(4,4,4-trifluorobutyl)piperidin-3-amine.
| Compound Name | (3S)-1-(cyclohexylmethyl)-N-(4,4,4-trifluorobutyl)piperidin-3-amine |
|---|---|
| PubChem CID | 51633656 |
| Molecular Formula | C16H29F3N2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | (3S)-1-(cyclohexylmethyl)-N-(4,4,4-trifluorobutyl)piperidin-3-amine |
| SMILES | FC(F)(F)CCCN[C@H]1CCCN(CC2CCCCC2)C1 |
| InChI | InChI=1S/C16H29F3N2/c17-16(18,19)9-5-10-20-15-8-4-11-21(13-15)12-14-6-2-1-3-7-14/h14-15,20H,1-13H2/t15-/m0/s1 |
| InChIKey | RGDMUEHPOQKTJY-HNNXBMFYSA-N |
| XLogP | 3.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|