C20H31FN2O — CID 51635194
(3R)-1-(cyclohexylmethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-3-amine (PubChem CID 51635194) has the molecular formula C20H31FN2O and a molecular weight of 334.48 g/mol. Its IUPAC name is (3R)-1-(cyclohexylmethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-3-amine.
| Compound Name | (3R)-1-(cyclohexylmethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 51635194 |
| Molecular Formula | C20H31FN2O |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (3R)-1-(cyclohexylmethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-3-amine |
| SMILES | COc1ccc(CN[C@@H]2CCCN(CC3CCCCC3)C2)cc1F |
| InChI | InChI=1S/C20H31FN2O/c1-24-20-10-9-17(12-19(20)21)13-22-18-8-5-11-23(15-18)14-16-6-3-2-4-7-16/h9-10,12,16,18,22H,2-8,11,13-15H2,1H3/t18-/m1/s1 |
| InChIKey | MTTNCEAOECIPGF-GOSISDBHSA-N |
| XLogP | 3.97 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |