C20H30N4 — CID 51635795
(3R)-N-(1H-benzimidazol-2-ylmethyl)-1-(cyclohexylmethyl)piperidin-3-amine (PubChem CID 51635795) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is (3R)-N-(1H-benzimidazol-2-ylmethyl)-1-(cyclohexylmethyl)piperidin-3-amine.
| Compound Name | (3R)-N-(1H-benzimidazol-2-ylmethyl)-1-(cyclohexylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 51635795 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (3R)-N-(1H-benzimidazol-2-ylmethyl)-1-(cyclohexylmethyl)piperidin-3-amine |
| SMILES | c1ccc2[nH]c(CN[C@@H]3CCCN(CC4CCCCC4)C3)nc2c1 |
| InChI | InChI=1S/C20H30N4/c1-2-7-16(8-3-1)14-24-12-6-9-17(15-24)21-13-20-22-18-10-4-5-11-19(18)23-20/h4-5,10-11,16-17,21H,1-3,6-9,12-15H2,(H,22,23)/t17-/m1/s1 |
| InChIKey | ZNGSIQHIVXLVOX-QGZVFWFLSA-N |
| XLogP | 3.70 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |