C13H13ClN2O — CID 5163692
1-(4-chlorophenyl)-2-(3,5-dimethylpyrazol-1-yl)ethanone (PubChem CID 5163692) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(3,5-dimethylpyrazol-1-yl)ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-(3,5-dimethylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 5163692 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(3,5-dimethylpyrazol-1-yl)ethanone |
| SMILES | Cc1cc(C)n(CC(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H13ClN2O/c1-9-7-10(2)16(15-9)8-13(17)11-3-5-12(14)6-4-11/h3-7H,8H2,1-2H3 |
| InChIKey | DUCHKCRRVOSXGM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |