C21H22N2O5 — CID 51644899
(2-phenyl-1,3-oxazol-4-yl)methyl 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 51644899) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | (2-phenyl-1,3-oxazol-4-yl)methyl 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 51644899 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (2-phenyl-1,3-oxazol-4-yl)methyl 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O)OCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H22N2O5/c24-18(10-11-23-20(25)16-8-4-5-9-17(16)21(23)26)27-12-15-13-28-19(22-15)14-6-2-1-3-7-14/h1-3,6-7,13,16-17H,4-5,8-12H2/t16-,17-/m0/s1 |
| InChIKey | HETWYDIQDJUYQT-IRXDYDNUSA-N |
| XLogP | 2.95 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|