C15H14N6O3S2 — CID 5165692
2-(1-phenyltetrazol-5-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 5165692) has the molecular formula C15H14N6O3S2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-(1-phenyltetrazol-5-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(1-phenyltetrazol-5-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 5165692 |
| Molecular Formula | C15H14N6O3S2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-(1-phenyltetrazol-5-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)CSc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C15H14N6O3S2/c16-26(23,24)13-8-4-5-11(9-13)17-14(22)10-25-15-18-19-20-21(15)12-6-2-1-3-7-12/h1-9H,10H2,(H,17,22)(H2,16,23,24) |
| InChIKey | IKVMKUQYXIGGEA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |