C13H18N6O2S — CID 516579
6-(4-methylpiperazin-1-yl)sulfonylquinazoline-2,4-diamine (PubChem CID 516579) has the molecular formula C13H18N6O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)sulfonylquinazoline-2,4-diamine.
| Compound Name | 6-(4-methylpiperazin-1-yl)sulfonylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 516579 |
| Molecular Formula | C13H18N6O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)sulfonylquinazoline-2,4-diamine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc3nc(N)nc(N)c3c2)CC1 |
| InChI | InChI=1S/C13H18N6O2S/c1-18-4-6-19(7-5-18)22(20,21)9-2-3-11-10(8-9)12(14)17-13(15)16-11/h2-3,8H,4-7H2,1H3,(H4,14,15,16,17) |
| InChIKey | WJIPXNDWOWNFHN-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |