C20H25N3O3S2 — CID 51662215
N-[2-(cyclohexen-1-yl)ethyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-5-thiophen-2-ylpyrazole-3-carboxamide (PubChem CID 51662215) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-5-thiophen-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-5-thiophen-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51662215 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-5-thiophen-2-ylpyrazole-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cc(-c2cccs2)n([C@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C20H25N3O3S2/c24-20(21-10-8-15-5-2-1-3-6-15)17-13-18(19-7-4-11-27-19)23(22-17)16-9-12-28(25,26)14-16/h4-5,7,11,13,16H,1-3,6,8-10,12,14H2,(H,21,24)/t16-/m0/s1 |
| InChIKey | SJDYVOBGUILLHZ-INIZCTEOSA-N |
| XLogP | 3.59 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|