C22H27NO5S — CID 51664911
6-O-methyl 3-O-propyl (4R,6S,7R)-2,7-dimethyl-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51664911) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is 6-O-methyl 3-O-propyl (4R,6S,7R)-2,7-dimethyl-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 6-O-methyl 3-O-propyl (4R,6S,7R)-2,7-dimethyl-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51664911 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 6-O-methyl 3-O-propyl (4R,6S,7R)-2,7-dimethyl-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCOC(=O)C1=C(C)NC2=C(C(=O)[C@@H](C(=O)OC)[C@H](C)C2)[C@H]1c1ccc(C)s1 |
| InChI | InChI=1S/C22H27NO5S/c1-6-9-28-22(26)17-13(4)23-14-10-11(2)16(21(25)27-5)20(24)18(14)19(17)15-8-7-12(3)29-15/h7-8,11,16,19,23H,6,9-10H2,1-5H3/t11-,16+,19+/m1/s1 |
| InChIKey | RPSITZNPYDKXTA-DQNAHFDYSA-N |
| XLogP | 3.62 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|