C25H31NO5S — CID 2960185
3-O-cyclohexyl 6-O-methyl 2,7-dimethyl-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 2960185) has the molecular formula C25H31NO5S and a molecular weight of 457.59 g/mol. Its IUPAC name is 3-O-cyclohexyl 6-O-methyl 2,7-dimethyl-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-cyclohexyl 6-O-methyl 2,7-dimethyl-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 2960185 |
| Molecular Formula | C25H31NO5S |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 3-O-cyclohexyl 6-O-methyl 2,7-dimethyl-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C2=C(CC1C)NC(C)=C(C(=O)OC1CCCCC1)C2c1ccc(C)s1 |
| InChI | InChI=1S/C25H31NO5S/c1-13-12-17-21(23(27)19(13)24(28)30-4)22(18-11-10-14(2)32-18)20(15(3)26-17)25(29)31-16-8-6-5-7-9-16/h10-11,13,16,19,22,26H,5-9,12H2,1-4H3 |
| InChIKey | WLIQMUJDCKXAOQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|