C26H34FN3O4 — CID 51668418
(1S,2R,5S,6R,7R)-2-N-tert-butyl-6-N-(2-fluorophenyl)-7-methyl-3-(2-methylbutan-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 51668418) has the molecular formula C26H34FN3O4 and a molecular weight of 471.57 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R)-2-N-tert-butyl-6-N-(2-fluorophenyl)-7-methyl-3-(2-methylbutan-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6R,7R)-2-N-tert-butyl-6-N-(2-fluorophenyl)-7-methyl-3-(2-methylbutan-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 51668418 |
| Molecular Formula | C26H34FN3O4 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | (1S,2R,5S,6R,7R)-2-N-tert-butyl-6-N-(2-fluorophenyl)-7-methyl-3-(2-methylbutan-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCC(C)(C)N1C(=O)[C@H]2[C@@H](C(=O)Nc3ccccc3F)[C@@]3(C)C=C[C@@]2(O3)[C@@H]1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C26H34FN3O4/c1-8-24(5,6)30-19(21(32)29-23(2,3)4)26-14-13-25(7,34-26)17(18(26)22(30)33)20(31)28-16-12-10-9-11-15(16)27/h9-14,17-19H,8H2,1-7H3,(H,28,31)(H,29,32)/t17-,18+,19-,25+,26-/m0/s1 |
| InChIKey | QETOSKFACAUVHS-LWKKZUAWSA-N |
| XLogP | 3.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|