C22H26ClN3O6S — CID 51671961
4-chloro-N-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-methoxyphenyl)-3-nitrobenzenesulfonamide (PubChem CID 51671961) has the molecular formula C22H26ClN3O6S and a molecular weight of 495.99 g/mol. Its IUPAC name is 4-chloro-N-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-methoxyphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-methoxyphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 51671961 |
| Molecular Formula | C22H26ClN3O6S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 4-chloro-N-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-methoxyphenyl)-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(N(CC(=O)N2C[C@@H](C)C[C@H](C)C2)S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H26ClN3O6S/c1-15-10-16(2)13-24(12-15)22(27)14-25(17-4-6-18(32-3)7-5-17)33(30,31)19-8-9-20(23)21(11-19)26(28)29/h4-9,11,15-16H,10,12-14H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | AUJDYLPFJIZIRD-HOTGVXAUSA-N |
| XLogP | 3.96 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|