C24H22ClN3O6S — CID 25376534
4-chloro-N-(4-methoxyphenyl)-N-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]-3-nitrobenzenesulfonamide (PubChem CID 25376534) has the molecular formula C24H22ClN3O6S and a molecular weight of 515.98 g/mol. Its IUPAC name is 4-chloro-N-(4-methoxyphenyl)-N-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-(4-methoxyphenyl)-N-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 25376534 |
| Molecular Formula | C24H22ClN3O6S |
| Molecular Weight | 515.98 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 4-chloro-N-(4-methoxyphenyl)-N-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(N(CC(=O)N2c3ccccc3C[C@@H]2C)S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H22ClN3O6S/c1-16-13-17-5-3-4-6-22(17)27(16)24(29)15-26(18-7-9-19(34-2)10-8-18)35(32,33)20-11-12-21(25)23(14-20)28(30)31/h3-12,14,16H,13,15H2,1-2H3/t16-/m0/s1 |
| InChIKey | INMDMIGLMBBMKR-INIZCTEOSA-N |
| XLogP | 4.43 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|