C23H21IN2O3S — CID 124560578
N-(4-iodophenyl)-N-[2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]benzenesulfonamide (PubChem CID 124560578) has the molecular formula C23H21IN2O3S and a molecular weight of 532.40 g/mol. Its IUPAC name is N-(4-iodophenyl)-N-[2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | N-(4-iodophenyl)-N-[2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124560578 |
| Molecular Formula | C23H21IN2O3S |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | N-(4-iodophenyl)-N-[2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]benzenesulfonamide |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21IN2O3S/c1-17-15-18-7-5-6-10-22(18)26(17)23(27)16-25(20-13-11-19(24)12-14-20)30(28,29)21-8-3-2-4-9-21/h2-14,17H,15-16H2,1H3/t17-/m1/s1 |
| InChIKey | XUKFSRQBACQKAV-QGZVFWFLSA-N |
| XLogP | 4.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|