C28H31NO6S — CID 51672815
[(2S)-oxolan-2-yl]methyl (4R,7R)-4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 51672815) has the molecular formula C28H31NO6S and a molecular weight of 509.62 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl (4R,7R)-4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl (4R,7R)-4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 51672815 |
| Molecular Formula | C28H31NO6S |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl (4R,7R)-4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2C(C(=O)OC[C@@H]3CCCO3)=C(C)NC3=C2C(=O)C[C@H](c2cccs2)C3)cc1OC |
| InChI | InChI=1S/C28H31NO6S/c1-16-25(28(31)35-15-19-6-4-10-34-19)26(17-8-9-22(32-2)23(14-17)33-3)27-20(29-16)12-18(13-21(27)30)24-7-5-11-36-24/h5,7-9,11,14,18-19,26,29H,4,6,10,12-13,15H2,1-3H3/t18-,19+,26+/m1/s1 |
| InChIKey | HPCXPFNJSIBWTH-MVYHEMRASA-N |
| XLogP | 4.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |