C18H26N6O3S — CID 51672917
2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamoyl]acetamide (PubChem CID 51672917) has the molecular formula C18H26N6O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamoyl]acetamide.
| Compound Name | 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 51672917 |
| Molecular Formula | C18H26N6O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamoyl]acetamide |
| SMILES | Cc1occc1-c1nnc(SCC(=O)NC(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)n1N |
| InChI | InChI=1S/C18H26N6O3S/c1-10-5-4-6-14(11(10)2)20-17(26)21-15(25)9-28-18-23-22-16(24(18)19)13-7-8-27-12(13)3/h7-8,10-11,14H,4-6,9,19H2,1-3H3,(H2,20,21,25,26)/t10-,11+,14-/m1/s1 |
| InChIKey | BYWLMOYGAZJADU-UHIISALHSA-N |
| XLogP | 2.30 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |