About N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline
N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline (PubChem CID 5167852) has the molecular formula C16H16Cl2N4
and a molecular weight of 335.24 g/mol. Its IUPAC name is N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline.
Molecular Properties
| Compound Name | N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline |
| PubChem CID | 5167852 |
| Molecular Formula | C16H16Cl2N4 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline |
| SMILES | CCCC(Nc1cc(Cl)cc(Cl)c1)n1nnc2ccccc21 |
| InChI | InChI=1S/C16H16Cl2N4/c1-2-5-16(19-13-9-11(17)8-12(18)10-13)22-15-7-4-3-6-14(15)20-21-22/h3-4,6-10,16,19H,2,5H2,1H3 |
| InChIKey | VICQFCQZTYSEIL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline?
The IUPAC name of N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline (CID 5167852) is N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline.
What is the SMILES notation for N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline?
The canonical SMILES for N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline is CCCC(Nc1cc(Cl)cc(Cl)c1)n1nnc2ccccc21.
What is the InChIKey of N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline?
The InChIKey is VICQFCQZTYSEIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2N4/c1-2-5-16(19-13-9-11(17)8-12(18)10-13)22-15-7-4-3-6-14(15)20-21-22/h3-4,6-10,16,19H,2,5H2,1H3.
What are the key properties of N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline?
N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline has a molecular weight of 335.24 g/mol, XLogP of 5.15, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(benzotriazol-1-yl)butyl]-3,5-dichloroaniline is sourced from PubChem (CID 5167852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).