C10H13N3O — CID 51681205
6-[[(2S)-1-hydroxybutan-2-yl]amino]pyridine-3-carbonitrile (PubChem CID 51681205) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 6-[[(2S)-1-hydroxybutan-2-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[(2S)-1-hydroxybutan-2-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 51681205 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 6-[[(2S)-1-hydroxybutan-2-yl]amino]pyridine-3-carbonitrile |
| SMILES | CC[C@@H](CO)Nc1ccc(C#N)cn1 |
| InChI | InChI=1S/C10H13N3O/c1-2-9(7-14)13-10-4-3-8(5-11)6-12-10/h3-4,6,9,14H,2,7H2,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | QZAZKGUMAAWNHG-VIFPVBQESA-N |
| XLogP | 1.14 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |