C16H17N3O2S — CID 122150706
6-[1-(benzenesulfonyl)butan-2-ylamino]pyridine-3-carbonitrile (PubChem CID 122150706) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 6-[1-(benzenesulfonyl)butan-2-ylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[1-(benzenesulfonyl)butan-2-ylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 122150706 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 6-[1-(benzenesulfonyl)butan-2-ylamino]pyridine-3-carbonitrile |
| SMILES | CCC(CS(=O)(=O)c1ccccc1)Nc1ccc(C#N)cn1 |
| InChI | InChI=1S/C16H17N3O2S/c1-2-14(19-16-9-8-13(10-17)11-18-16)12-22(20,21)15-6-4-3-5-7-15/h3-9,11,14H,2,12H2,1H3,(H,18,19) |
| InChIKey | FNTFJGXMHSCUPN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |