C16H13N3 — CID 75390358
6-(1-phenylbut-3-ynylamino)pyridine-3-carbonitrile (PubChem CID 75390358) has the molecular formula C16H13N3 and a molecular weight of 247.30 g/mol. Its IUPAC name is 6-(1-phenylbut-3-ynylamino)pyridine-3-carbonitrile.
| Compound Name | 6-(1-phenylbut-3-ynylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 75390358 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6-(1-phenylbut-3-ynylamino)pyridine-3-carbonitrile |
| SMILES | C#CCC(Nc1ccc(C#N)cn1)c1ccccc1 |
| InChI | InChI=1S/C16H13N3/c1-2-6-15(14-7-4-3-5-8-14)19-16-10-9-13(11-17)12-18-16/h1,3-5,7-10,12,15H,6H2,(H,18,19) |
| InChIKey | WGSQARYKDPGPNM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|