C22H33NO3 — CID 51683629
(2R)-1-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-3-[2-(4-methoxyphenyl)ethylamino]propan-2-ol (PubChem CID 51683629) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (2R)-1-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-3-[2-(4-methoxyphenyl)ethylamino]propan-2-ol.
| Compound Name | (2R)-1-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-3-[2-(4-methoxyphenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 51683629 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (2R)-1-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-3-[2-(4-methoxyphenyl)ethylamino]propan-2-ol |
| SMILES | COc1ccc(CCNC[C@@H](O)COCC2=CC[C@@H]3C[C@H]2C3(C)C)cc1 |
| InChI | InChI=1S/C22H33NO3/c1-22(2)18-7-6-17(21(22)12-18)14-26-15-19(24)13-23-11-10-16-4-8-20(25-3)9-5-16/h4-6,8-9,18-19,21,23-24H,7,10-15H2,1-3H3/t18-,19-,21-/m1/s1 |
| InChIKey | WLNQZNJOYYZTHB-SFHLNBCPSA-N |
| XLogP | 3.20 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|