C23H20N4O2S — CID 51689308
(4aR,5R)-8-nitro-5-(4-phenyl-1,3-thiazol-2-yl)-1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5-carbonitrile (PubChem CID 51689308) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is (4aR,5R)-8-nitro-5-(4-phenyl-1,3-thiazol-2-yl)-1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5-carbonitrile.
| Compound Name | (4aR,5R)-8-nitro-5-(4-phenyl-1,3-thiazol-2-yl)-1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5-carbonitrile |
|---|---|
| PubChem CID | 51689308 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (4aR,5R)-8-nitro-5-(4-phenyl-1,3-thiazol-2-yl)-1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5-carbonitrile |
| SMILES | N#C[C@@]1(c2nc(-c3ccccc3)cs2)Cc2cc([N+](=O)[O-])ccc2N2CCCC[C@@H]21 |
| InChI | InChI=1S/C23H20N4O2S/c24-15-23(22-25-19(14-30-22)16-6-2-1-3-7-16)13-17-12-18(27(28)29)9-10-20(17)26-11-5-4-8-21(23)26/h1-3,6-7,9-10,12,14,21H,4-5,8,11,13H2/t21-,23+/m1/s1 |
| InChIKey | ODRWOUKIHMCLJQ-GGAORHGYSA-N |
| XLogP | 5.09 |
| TPSA | 83.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|