C19H18N4O2 — CID 25349883
(4aS,5R)-8-nitro-5-pyridin-2-yl-1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5-carbonitrile (PubChem CID 25349883) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (4aS,5R)-8-nitro-5-pyridin-2-yl-1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5-carbonitrile.
| Compound Name | (4aS,5R)-8-nitro-5-pyridin-2-yl-1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5-carbonitrile |
|---|---|
| PubChem CID | 25349883 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (4aS,5R)-8-nitro-5-pyridin-2-yl-1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5-carbonitrile |
| SMILES | N#C[C@]1(c2ccccn2)Cc2cc([N+](=O)[O-])ccc2N2CCCC[C@H]21 |
| InChI | InChI=1S/C19H18N4O2/c20-13-19(17-5-1-3-9-21-17)12-14-11-15(23(24)25)7-8-16(14)22-10-4-2-6-18(19)22/h1,3,5,7-9,11,18H,2,4,6,10,12H2/t18-,19-/m0/s1 |
| InChIKey | MISRPTAWNSSWEW-OALUTQOASA-N |
| XLogP | 3.37 |
| TPSA | 83.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|