C23H15ClN4O5S — CID 51695102
N-[5-chloro-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 51695102) has the molecular formula C23H15ClN4O5S and a molecular weight of 494.92 g/mol. Its IUPAC name is N-[5-chloro-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[5-chloro-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 51695102 |
| Molecular Formula | C23H15ClN4O5S |
| Molecular Weight | 494.92 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | N-[5-chloro-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1cc(Cl)ccc1OCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C23H15ClN4O5S/c24-13-5-6-18(33-12-14-10-20(30)27-7-8-34-23(27)25-14)17(9-13)26-19(29)11-28-21(31)15-3-1-2-4-16(15)22(28)32/h1-10H,11-12H2,(H,26,29) |
| InChIKey | AMHHZTOYSHSUFT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.92 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|