C18H22N2O — CID 51696070
N-[(1S,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]benzamide (PubChem CID 51696070) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[(1S,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]benzamide.
| Compound Name | N-[(1S,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 51696070 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[(1S,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1)[C@H](c1ccccc1)N(C)C |
| InChI | InChI=1S/C18H22N2O/c1-14(19-18(21)16-12-8-5-9-13-16)17(20(2)3)15-10-6-4-7-11-15/h4-14,17H,1-3H3,(H,19,21)/t14-,17-/m1/s1 |
| InChIKey | BSEBOXRPIWDTLS-RHSMWYFYSA-N |
| XLogP | 3.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |