C18H26N2O — CID 119036959
N-[1-(dimethylamino)-1-phenylpropan-2-yl]-2,2-dimethylpent-4-ynamide (PubChem CID 119036959) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[1-(dimethylamino)-1-phenylpropan-2-yl]-2,2-dimethylpent-4-ynamide.
| Compound Name | N-[1-(dimethylamino)-1-phenylpropan-2-yl]-2,2-dimethylpent-4-ynamide |
|---|---|
| PubChem CID | 119036959 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-[1-(dimethylamino)-1-phenylpropan-2-yl]-2,2-dimethylpent-4-ynamide |
| SMILES | C#CCC(C)(C)C(=O)NC(C)C(c1ccccc1)N(C)C |
| InChI | InChI=1S/C18H26N2O/c1-7-13-18(3,4)17(21)19-14(2)16(20(5)6)15-11-9-8-10-12-15/h1,8-12,14,16H,13H2,2-6H3,(H,19,21) |
| InChIKey | PJSIIFKBWFXFBG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|