C26H28N2O4S — CID 51705757
(1R,2S,3S,4S)-3-[[3-[(3-methylphenyl)carbamoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 51705757) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is (1R,2S,3S,4S)-3-[[3-[(3-methylphenyl)carbamoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3S,4S)-3-[[3-[(3-methylphenyl)carbamoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 51705757 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (1R,2S,3S,4S)-3-[[3-[(3-methylphenyl)carbamoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | Cc1cccc(NC(=O)c2c(NC(=O)[C@@H]3[C@@H](C(=O)O)[C@H]4C=C[C@@H]3C4)sc3c2CCCCC3)c1 |
| InChI | InChI=1S/C26H28N2O4S/c1-14-6-5-7-17(12-14)27-24(30)22-18-8-3-2-4-9-19(18)33-25(22)28-23(29)20-15-10-11-16(13-15)21(20)26(31)32/h5-7,10-12,15-16,20-21H,2-4,8-9,13H2,1H3,(H,27,30)(H,28,29)(H,31,32)/t15-,16+,20+,21+/m1/s1 |
| InChIKey | QAXFTQRBJCFMKX-ALGWMNEGSA-N |
| XLogP | 5.04 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|