C23H30BrNO4 — CID 51708595
(3R,4R)-4-[(2S)-1-(4-bromophenyl)-1-oxobutan-2-yl]-N-cyclohexyl-5,5-dimethyl-2-oxooxolane-3-carboxamide (PubChem CID 51708595) has the molecular formula C23H30BrNO4 and a molecular weight of 464.40 g/mol. Its IUPAC name is (3R,4R)-4-[(2S)-1-(4-bromophenyl)-1-oxobutan-2-yl]-N-cyclohexyl-5,5-dimethyl-2-oxooxolane-3-carboxamide.
| Compound Name | (3R,4R)-4-[(2S)-1-(4-bromophenyl)-1-oxobutan-2-yl]-N-cyclohexyl-5,5-dimethyl-2-oxooxolane-3-carboxamide |
|---|---|
| PubChem CID | 51708595 |
| Molecular Formula | C23H30BrNO4 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | (3R,4R)-4-[(2S)-1-(4-bromophenyl)-1-oxobutan-2-yl]-N-cyclohexyl-5,5-dimethyl-2-oxooxolane-3-carboxamide |
| SMILES | CC[C@H](C(=O)c1ccc(Br)cc1)[C@@H]1[C@H](C(=O)NC2CCCCC2)C(=O)OC1(C)C |
| InChI | InChI=1S/C23H30BrNO4/c1-4-17(20(26)14-10-12-15(24)13-11-14)19-18(22(28)29-23(19,2)3)21(27)25-16-8-6-5-7-9-16/h10-13,16-19H,4-9H2,1-3H3,(H,25,27)/t17-,18+,19+/m0/s1 |
| InChIKey | SEWAQZYWHPLUEA-IPMKNSEASA-N |
| XLogP | 4.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|