C24H26BrNO4 — CID 51666041
(3R,4R)-N-benzyl-4-[(2S)-1-(4-bromophenyl)-1-oxobutan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxamide (PubChem CID 51666041) has the molecular formula C24H26BrNO4 and a molecular weight of 472.38 g/mol. Its IUPAC name is (3R,4R)-N-benzyl-4-[(2S)-1-(4-bromophenyl)-1-oxobutan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxamide.
| Compound Name | (3R,4R)-N-benzyl-4-[(2S)-1-(4-bromophenyl)-1-oxobutan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxamide |
|---|---|
| PubChem CID | 51666041 |
| Molecular Formula | C24H26BrNO4 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | (3R,4R)-N-benzyl-4-[(2S)-1-(4-bromophenyl)-1-oxobutan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxamide |
| SMILES | CC[C@H](C(=O)c1ccc(Br)cc1)[C@@H]1[C@H](C(=O)NCc2ccccc2)C(=O)OC1(C)C |
| InChI | InChI=1S/C24H26BrNO4/c1-4-18(21(27)16-10-12-17(25)13-11-16)20-19(23(29)30-24(20,2)3)22(28)26-14-15-8-6-5-7-9-15/h5-13,18-20H,4,14H2,1-3H3,(H,26,28)/t18-,19+,20+/m0/s1 |
| InChIKey | DGWKURPWJHZDER-XUVXKRRUSA-N |
| XLogP | 4.54 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|