C19H27NO3 — CID 87478332
(2R,3S)-2-[(2S)-butan-2-yl]-N-[(4-tert-butylphenyl)methyl]-4-oxooxetane-3-carboxamide (PubChem CID 87478332) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2R,3S)-2-[(2S)-butan-2-yl]-N-[(4-tert-butylphenyl)methyl]-4-oxooxetane-3-carboxamide.
| Compound Name | (2R,3S)-2-[(2S)-butan-2-yl]-N-[(4-tert-butylphenyl)methyl]-4-oxooxetane-3-carboxamide |
|---|---|
| PubChem CID | 87478332 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (2R,3S)-2-[(2S)-butan-2-yl]-N-[(4-tert-butylphenyl)methyl]-4-oxooxetane-3-carboxamide |
| SMILES | CC[C@H](C)[C@H]1OC(=O)[C@@H]1C(=O)NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H27NO3/c1-6-12(2)16-15(18(22)23-16)17(21)20-11-13-7-9-14(10-8-13)19(3,4)5/h7-10,12,15-16H,6,11H2,1-5H3,(H,20,21)/t12-,15-,16+/m0/s1 |
| InChIKey | JGMBABQZXVRDEQ-VBNZEHGJSA-N |
| XLogP | 3.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|