C21H33NO2 — CID 71095008
(3S,4S)-3-acetyl-N-[(4-tert-butylphenyl)methyl]-2,4-dimethylhexanamide (PubChem CID 71095008) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is (3S,4S)-3-acetyl-N-[(4-tert-butylphenyl)methyl]-2,4-dimethylhexanamide.
| Compound Name | (3S,4S)-3-acetyl-N-[(4-tert-butylphenyl)methyl]-2,4-dimethylhexanamide |
|---|---|
| PubChem CID | 71095008 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | (3S,4S)-3-acetyl-N-[(4-tert-butylphenyl)methyl]-2,4-dimethylhexanamide |
| SMILES | CC[C@H](C)[C@H](C(C)=O)C(C)C(=O)NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H33NO2/c1-8-14(2)19(16(4)23)15(3)20(24)22-13-17-9-11-18(12-10-17)21(5,6)7/h9-12,14-15,19H,8,13H2,1-7H3,(H,22,24)/t14-,15?,19-/m0/s1 |
| InChIKey | YJNYDLPRNDTIFG-OCGXIWQUSA-N |
| XLogP | 4.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |