C18H21N3O6 — CID 51721496
(2R)-2-[1-(carboxymethyl)-5-methoxyindol-3-yl]-2-(4-formylpiperazin-1-yl)acetic acid (PubChem CID 51721496) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is (2R)-2-[1-(carboxymethyl)-5-methoxyindol-3-yl]-2-(4-formylpiperazin-1-yl)acetic acid.
| Compound Name | (2R)-2-[1-(carboxymethyl)-5-methoxyindol-3-yl]-2-(4-formylpiperazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 51721496 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (2R)-2-[1-(carboxymethyl)-5-methoxyindol-3-yl]-2-(4-formylpiperazin-1-yl)acetic acid |
| SMILES | COc1ccc2c(c1)c([C@H](C(=O)O)N1CCN(C=O)CC1)cn2CC(=O)O |
| InChI | InChI=1S/C18H21N3O6/c1-27-12-2-3-15-13(8-12)14(9-21(15)10-16(23)24)17(18(25)26)20-6-4-19(11-22)5-7-20/h2-3,8-9,11,17H,4-7,10H2,1H3,(H,23,24)(H,25,26)/t17-/m1/s1 |
| InChIKey | FOJQTDAWKWJSFZ-QGZVFWFLSA-N |
| XLogP | 0.63 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|