C20H27N3O6 — CID 51719663
(2R)-2-[1-(carboxymethyl)indol-3-yl]-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]acetic acid (PubChem CID 51719663) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is (2R)-2-[1-(carboxymethyl)indol-3-yl]-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]acetic acid.
| Compound Name | (2R)-2-[1-(carboxymethyl)indol-3-yl]-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 51719663 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (2R)-2-[1-(carboxymethyl)indol-3-yl]-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc([C@H](C(=O)O)N2CCN(CCOCCO)CC2)c2ccccc21 |
| InChI | InChI=1S/C20H27N3O6/c24-10-12-29-11-9-21-5-7-22(8-6-21)19(20(27)28)16-13-23(14-18(25)26)17-4-2-1-3-15(16)17/h1-4,13,19,24H,5-12,14H2,(H,25,26)(H,27,28)/t19-/m1/s1 |
| InChIKey | ZMLAIETVUUZKIF-LJQANCHMSA-N |
| XLogP | 0.48 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|