C19H29NO3 — CID 51723970
3-(2,3-dimethoxyphenyl)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 51723970) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | 3-(2,3-dimethoxyphenyl)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 51723970 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | COc1cccc(CCC(=O)N[C@@H]2CCC[C@@H](C)[C@H]2C)c1OC |
| InChI | InChI=1S/C19H29NO3/c1-13-7-5-9-16(14(13)2)20-18(21)12-11-15-8-6-10-17(22-3)19(15)23-4/h6,8,10,13-14,16H,5,7,9,11-12H2,1-4H3,(H,20,21)/t13-,14-,16-/m1/s1 |
| InChIKey | MSANAUHGEBQFEO-IIAWOOMASA-N |
| XLogP | 3.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |