C24H30N2O4 — CID 51724508
ethyl (3S)-1-[(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]piperidine-3-carboxylate (PubChem CID 51724508) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is ethyl (3S)-1-[(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 51724508 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | ethyl (3S)-1-[(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN([C@H](C(=O)Nc2ccccc2OCC)c2ccccc2)C1 |
| InChI | InChI=1S/C24H30N2O4/c1-3-29-21-15-9-8-14-20(21)25-23(27)22(18-11-6-5-7-12-18)26-16-10-13-19(17-26)24(28)30-4-2/h5-9,11-12,14-15,19,22H,3-4,10,13,16-17H2,1-2H3,(H,25,27)/t19-,22-/m0/s1 |
| InChIKey | HFUCEGYVZWQMBK-UGKGYDQZSA-N |
| XLogP | 4.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |