C23H24ClN3O3S — CID 5172911
2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 5172911) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is 2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 5172911 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | COc1ccc(C=C2SC(N3CCN(c4ccc(C)c(Cl)c4)CC3)=NC2=O)cc1OC |
| InChI | InChI=1S/C23H24ClN3O3S/c1-15-4-6-17(14-18(15)24)26-8-10-27(11-9-26)23-25-22(28)21(31-23)13-16-5-7-19(29-2)20(12-16)30-3/h4-7,12-14H,8-11H2,1-3H3 |
| InChIKey | FSVDUJZFBZFBAM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|