C29H32N2O3S — CID 5177162
1-[benzyl(3-thiophen-2-ylprop-2-enoyl)amino]-N-(4-methoxyphenyl)-4-methylcyclohexane-1-carboxamide (PubChem CID 5177162) has the molecular formula C29H32N2O3S and a molecular weight of 488.65 g/mol. Its IUPAC name is 1-[benzyl(3-thiophen-2-ylprop-2-enoyl)amino]-N-(4-methoxyphenyl)-4-methylcyclohexane-1-carboxamide.
| Compound Name | 1-[benzyl(3-thiophen-2-ylprop-2-enoyl)amino]-N-(4-methoxyphenyl)-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5177162 |
| Molecular Formula | C29H32N2O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 1-[benzyl(3-thiophen-2-ylprop-2-enoyl)amino]-N-(4-methoxyphenyl)-4-methylcyclohexane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(N(Cc3ccccc3)C(=O)C=Cc3cccs3)CCC(C)CC2)cc1 |
| InChI | InChI=1S/C29H32N2O3S/c1-22-16-18-29(19-17-22,28(33)30-24-10-12-25(34-2)13-11-24)31(21-23-7-4-3-5-8-23)27(32)15-14-26-9-6-20-35-26/h3-15,20,22H,16-19,21H2,1-2H3,(H,30,33) |
| InChIKey | YUKDCXQXOKDGSX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|