C16H19ClN2O3 — CID 5177219
2-chloro-N-[2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-ylidene)ethylideneamino]benzamide (PubChem CID 5177219) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-chloro-N-[2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-ylidene)ethylideneamino]benzamide.
| Compound Name | 2-chloro-N-[2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-ylidene)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 5177219 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-chloro-N-[2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-ylidene)ethylideneamino]benzamide |
| SMILES | CC1(C)OC(=CC=NNC(=O)c2ccccc2Cl)OC1(C)C |
| InChI | InChI=1S/C16H19ClN2O3/c1-15(2)16(3,4)22-13(21-15)9-10-18-19-14(20)11-7-5-6-8-12(11)17/h5-10H,1-4H3,(H,19,20) |
| InChIKey | PCULYJKGAMEEOM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|