C18H27N3O2 — CID 5177812
N'-[1-(4-tert-butylphenyl)ethenyl]-2-morpholin-4-ylacetohydrazide (PubChem CID 5177812) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N'-[1-(4-tert-butylphenyl)ethenyl]-2-morpholin-4-ylacetohydrazide.
| Compound Name | N'-[1-(4-tert-butylphenyl)ethenyl]-2-morpholin-4-ylacetohydrazide |
|---|---|
| PubChem CID | 5177812 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N'-[1-(4-tert-butylphenyl)ethenyl]-2-morpholin-4-ylacetohydrazide |
| SMILES | C=C(NNC(=O)CN1CCOCC1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27N3O2/c1-14(15-5-7-16(8-6-15)18(2,3)4)19-20-17(22)13-21-9-11-23-12-10-21/h5-8,19H,1,9-13H2,2-4H3,(H,20,22) |
| InChIKey | KILSHESRLRJMLV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|