C18H25Br3O2S — CID 518033
1-nonyl-4-(2,3,3-tribromoprop-2-enylsulfonyl)benzene (PubChem CID 518033) has the molecular formula C18H25Br3O2S and a molecular weight of 545.18 g/mol. Its IUPAC name is 1-nonyl-4-(2,3,3-tribromoprop-2-enylsulfonyl)benzene.
| Compound Name | 1-nonyl-4-(2,3,3-tribromoprop-2-enylsulfonyl)benzene |
|---|---|
| PubChem CID | 518033 |
| Molecular Formula | C18H25Br3O2S |
| Molecular Weight | 545.18 g/mol |
| Exact Mass | 541.91 |
| IUPAC Name | 1-nonyl-4-(2,3,3-tribromoprop-2-enylsulfonyl)benzene |
| SMILES | CCCCCCCCCc1ccc(S(=O)(=O)CC(Br)=C(Br)Br)cc1 |
| InChI | InChI=1S/C18H25Br3O2S/c1-2-3-4-5-6-7-8-9-15-10-12-16(13-11-15)24(22,23)14-17(19)18(20)21/h10-13H,2-9,14H2,1H3 |
| InChIKey | RTZOATNWOWLQMY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.18 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|