C27H27N3O8 — CID 5180802
[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 5180802) has the molecular formula C27H27N3O8 and a molecular weight of 521.53 g/mol. Its IUPAC name is [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 5180802 |
| Molecular Formula | C27H27N3O8 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)OC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H27N3O8/c1-18(25(31)28-22-16-21(30(34)35)13-14-24(22)36-2)38-26(32)23(15-19-9-5-3-6-10-19)29-27(33)37-17-20-11-7-4-8-12-20/h3-14,16,18,23H,15,17H2,1-2H3,(H,28,31)(H,29,33) |
| InChIKey | IHQNKKHDJHRLSX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|